Products 602-25-5
CAS 602-25-5 appears in our catalog under these names: 1,4-Dichloroanthraquinone, min. 95 %, 5 g, 1,4-Dichloroanthraquinone, 95%, 1,4–Dichloroanthraquinone, 1,4-Dichloroanthraquinone, 1,4-Dichloroanthraquinone, >98.0%(GC). Offered by: Roth, Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 5g, 250mg, 1g, 200mg, 2g, 10g, 25g, 100g.
1,4-dichloroanthracene-9,10-dione (CAS 602-25-5) is a chemical compound with the molecular formula C14H6Cl2O2 and a molecular weight of 277.1 g/mol. IUPAC name: 1,4-dichloroanthracene-9,10-dione. InChIKey: CAHGWVAXFJXDNI-UHFFFAOYSA-N.
| Molecular formula | C14H6Cl2O2 |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | 1,4-dichloroanthracene-9,10-dione |
| InChIKey | CAHGWVAXFJXDNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
1,4-Dichloroanthraquinone, 1,4-dichloroanthracene-9,10-dione, 9,10-Anthracenedione, 1,4-dichloro-, 1,4-Dichloro-9,10-anthraquinone, 1,4-Dichlor-anthrachinon, 1,4-dichloro-9,10-dihydroanthracene-9,10-dione, 1,4-Dichloroanthraquinone, 97%, InChI=1/C14H6Cl2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6