CAS 60207-89-8 appears in our catalog under these names: 2-(Bromomethyl)-2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolane, Destriazolyl Bromo Propiconazole (Mixture of Diastereomers), >95% (HPLC), Destriazolyl bromo propiconazole. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 2,5g, 250mg, 5000mg.
2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolane (CAS 60207-89-8) is a chemical compound with the molecular formula C13H15BrCl2O2 and a molecular weight of 354.1 g/mol. IUPAC name: 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolane. InChIKey: PJVTZAKVRVBCMJ-UHFFFAOYSA-N.
| Molecular formula | C13H15BrCl2O2 |
|---|---|
| Molecular weight | 354.1 g/mol |
| IUPAC name | 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolane |
| InChIKey | PJVTZAKVRVBCMJ-UHFFFAOYSA-N |
| SMILES | CCCC1COC(O1)(CBr)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)