CAS 6027-81-2 appears in our catalog under these names: Guanine hydrochloride hydrate, 95%, 2-Amino-1H-purin-6(7H)-one hydrochloride hydrate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1kg, 500g, 100g, 5g, 1g.
2-amino-1,7-dihydropurin-6-one;hydrate;hydrochloride (CAS 6027-81-2) is a chemical compound with the molecular formula C5H8ClN5O2 and a molecular weight of 205.60 g/mol. IUPAC name: 2-amino-1,7-dihydropurin-6-one;hydrate;hydrochloride. InChIKey: RXLQFFCJFDDUET-UHFFFAOYSA-N.
| Molecular formula | C5H8ClN5O2 |
|---|---|
| Molecular weight | 205.60 g/mol |
| IUPAC name | 2-amino-1,7-dihydropurin-6-one;hydrate;hydrochloride |
| InChIKey | RXLQFFCJFDDUET-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=O)NC(=N2)N.O.Cl |
Computed by PubChem (NCBI)