CAS 60270-55-5 is the registry number for Potassium perfluoroheptanesulfonate, 99%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate (CAS 60270-55-5) is a chemical compound with the molecular formula C7F15KO3S and a molecular weight of 488.21 g/mol. IUPAC name: potassium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate. InChIKey: LBAKROCDOXEWPV-UHFFFAOYSA-M.
| Molecular formula | C7F15KO3S |
|---|---|
| Molecular weight | 488.21 g/mol |
| IUPAC name | potassium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate |
| InChIKey | LBAKROCDOXEWPV-UHFFFAOYSA-M |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(F)F)(F)F.[K+] |
Computed by PubChem (NCBI)