CAS 6029-82-9 is the registry number for 7-Angeloylretronecine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
[(1R,8R)-7-(hydroxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizin-1-yl] (Z)-2-methylbut-2-enoate (CAS 6029-82-9) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: [(1R,8R)-7-(hydroxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizin-1-yl] (Z)-2-methylbut-2-enoate. InChIKey: TYGYPIIOOQNWBU-BTRLNGJCSA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | [(1R,8R)-7-(hydroxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizin-1-yl] (Z)-2-methylbut-2-enoate |
| InChIKey | TYGYPIIOOQNWBU-BTRLNGJCSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@@H]1CCN2[C@@H]1C(=CC2)CO |
Computed by PubChem (NCBI)