CAS 603-36-1 appears in our catalog under these names: Triphenylantimony, 98%, Triphenylantimony, 99%, Triphenylantimony, Triphenylantimony/ 98%, Triphenylantimony, >95.0%(T). Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, TCI. Available pack sizes: 100g, 1g, 5g, 25g, on request, 500g, 50g.
Triphenylstibane (CAS 603-36-1) is a chemical compound with the molecular formula C18H15Sb and a molecular weight of 353.1 g/mol. IUPAC name: triphenylstibane. InChIKey: HVYVMSPIJIWUNA-UHFFFAOYSA-N.
| Molecular formula | C18H15Sb |
|---|---|
| Molecular weight | 353.1 g/mol |
| IUPAC name | triphenylstibane |
| InChIKey | HVYVMSPIJIWUNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Sb](C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)