Products 603-67-8
CAS 603-67-8 appears in our catalog under these names: Diethyl nitromalonate, 97%, Diethyl 2–nitromalonate, Diethyl 2-nitromalonate 97%, Diethyl 2-nitromalonate, 98%, 98%, Diethyl 2-nitromalonate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg, 50g.
Diethyl 2-nitropropanedioate (CAS 603-67-8) is a chemical compound with the molecular formula C7H11NO6 and a molecular weight of 205.17 g/mol. IUPAC name: diethyl 2-nitropropanedioate. InChIKey: DAKKWKYIQGMKOS-UHFFFAOYSA-N.
| Molecular formula | C7H11NO6 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | diethyl 2-nitropropanedioate |
| InChIKey | DAKKWKYIQGMKOS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Diethyl nitromalonate, Diethyl 2-nitromalonate, diethyl 2-nitropropanedioate, 1,3-diethyl 2-nitropropanedioate, Propanedioic acid, nitro-, diethyl ester, 2-Nitromalonic acid diethyl ester, Nitromalonic acid diethyl ester, Diethyl2-nitromalonate, DIETHYLNITROMALONATE, 2-Nitromalonic acid diethyl