CAS 603-85-0 appears in our catalog under these names: 2–Amino–3–nitrophenol, 2-Amino-3-nitrophenol, 98% , 2-Amino-3-nitrophenol, 2-Amino-3-nitrophenol, 98%, 2-Amino-3-nitrophenol, >98.0%(HPLC)(T). Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 100g, 5g, 25g, 1g, 10g, 500g, 1000g, 1kg.
2-amino-3-nitrophenol (CAS 603-85-0) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 2-amino-3-nitrophenol. InChIKey: KUCWUAFNGCMZDB-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 2-amino-3-nitrophenol |
| InChIKey | KUCWUAFNGCMZDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)