CAS 603-87-2 appears in our catalog under these names: 2-Amino-6-nitrophenol 95%, 2-Amino-6-nitrophenol, 96%, 2-Amino-6-nitrophenol, 95%, 95%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-amino-6-nitrophenol (CAS 603-87-2) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 2-amino-6-nitrophenol. InChIKey: AACMNEWXGKOJJK-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 2-amino-6-nitrophenol |
| InChIKey | AACMNEWXGKOJJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])O)N |
Computed by PubChem (NCBI)