Products 603126-32-5

CAS 603126-32-5 is the registry number for 1-p-Tolylnon-2-yn-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-(4-methylphenyl)non-2-yn-1-one (CAS 603126-32-5) is a chemical compound with the molecular formula C16H20O and a molecular weight of 228.33 g/mol. IUPAC name: 1-(4-methylphenyl)non-2-yn-1-one. InChIKey: MNGUORBSIAHVQD-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20O
Molecular weight228.33 g/mol
IUPAC name1-(4-methylphenyl)non-2-yn-1-one
InChIKeyMNGUORBSIAHVQD-UHFFFAOYSA-N
SMILESCCCCCCC#CC(=O)C1=CC=C(C=C1)C

Computed by PubChem (NCBI)