CAS 603300-92-1 is the registry number for tert-butyl 9-fluoro-3,4-dihydro-[1,4]diazepino[6,7,1-hi]indole-2(1h)-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate (CAS 603300-92-1) is a chemical compound with the molecular formula C16H19FN2O2 and a molecular weight of 290.33 g/mol. IUPAC name: tert-butyl 6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate. InChIKey: VPMZEHPGOOFIIF-UHFFFAOYSA-N.
| Molecular formula | C16H19FN2O2 |
|---|---|
| Molecular weight | 290.33 g/mol |
| IUPAC name | tert-butyl 6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate |
| InChIKey | VPMZEHPGOOFIIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C=CC3=CC(=CC(=C32)C1)F |
Computed by PubChem (NCBI)