Products 60354-61-2
CAS 60354-61-2 is the registry number for AAA-pNA, 98.29%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg, 50 mg.
(2S)-2-amino-N-[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]propanamide (CAS 60354-61-2) is a chemical compound with the molecular formula C15H21N5O5 and a molecular weight of 351.36 g/mol. IUPAC name: (2S)-2-amino-N-[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]propanamide. InChIKey: PNLFGUZFZPZVIB-GUBZILKMSA-N.
| Molecular formula | C15H21N5O5 |
|---|---|
| Molecular weight | 351.36 g/mol |
| IUPAC name | (2S)-2-amino-N-[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]propanamide |
| InChIKey | PNLFGUZFZPZVIB-GUBZILKMSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)