CAS 60374-43-8 appears in our catalog under these names: Bentazone-8-hydroxy, BENTAZONE–8–HYDROXY, 8-Hydroxybentazone, >95% (HPLC), 8-HYDROXY-3-ISOPROPYL-1H-2,1,3-BENZOTHIADIAZIN-4(3H)-ONE 2,2-DIOXIDE, 95%, 95%, Bentazone-8-hydroxy, Concentration: 10.0 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, GLPBio, HPC Standards, TRC, Chemat. Available pack sizes: 5mg, 25mg, 1x5mg, 10mg, 1mg, 50mg, 100mg, 250mg.
8-hydroxy-2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one (CAS 60374-43-8) is a chemical compound with the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. IUPAC name: 8-hydroxy-2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one. InChIKey: WJJLUCLOKVGHGK-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 8-hydroxy-2,2-dioxo-3-propan-2-yl-1H-2lambda6,1,3-benzothiadiazin-4-one |
| InChIKey | WJJLUCLOKVGHGK-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=C(C(=CC=C2)O)NS1(=O)=O |
Computed by PubChem (NCBI)