CAS 60398-55-2 is the registry number for 2-(Bis(diphenylphosphino)methyl)pyridine, 98%. Offered by: AmBeed. Available pack sizes: 100mg.
[diphenylphosphanyl(pyridin-2-yl)methyl]-diphenylphosphane (CAS 60398-55-2) is a chemical compound with the molecular formula C30H25NP2 and a molecular weight of 461.5 g/mol. IUPAC name: [diphenylphosphanyl(pyridin-2-yl)methyl]-diphenylphosphane. InChIKey: DBOQTXVSGUZHCU-UHFFFAOYSA-N.
| Molecular formula | C30H25NP2 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | [diphenylphosphanyl(pyridin-2-yl)methyl]-diphenylphosphane |
| InChIKey | DBOQTXVSGUZHCU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C(C3=CC=CC=N3)P(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)