CAS 604-95-5 appears in our catalog under these names: 2-Nitrophenanthraquinone, 95%, 2-Nitrophenanthraquinone. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 100mg, Get quote.
2-nitrophenanthrene-9,10-dione (CAS 604-95-5) is a chemical compound with the molecular formula C14H7NO4 and a molecular weight of 253.21 g/mol. IUPAC name: 2-nitrophenanthrene-9,10-dione. InChIKey: KNAXWOBOCVVMST-UHFFFAOYSA-N.
| Molecular formula | C14H7NO4 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 2-nitrophenanthrene-9,10-dione |
| InChIKey | KNAXWOBOCVVMST-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=C(C=C3)[N+](=O)[O-])C(=O)C2=O |
Computed by PubChem (NCBI)