Products 604010-60-8
CAS 604010-60-8 appears in our catalog under these names: Toremifene Impurity 2, Toremifene Impurity 4, Toremifene Impurity 14. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[4-[(1Z)-1,2-diphenylbuta-1,3-dienyl]phenoxy]-N,N-dimethylethanamine (CAS 604010-60-8) is a chemical compound with the molecular formula C26H27NO and a molecular weight of 369.5 g/mol. IUPAC name: 2-[4-[(1Z)-1,2-diphenylbuta-1,3-dienyl]phenoxy]-N,N-dimethylethanamine. InChIKey: AJNFVDSYBLVCQL-QPLCGJKRSA-N.
| Molecular formula | C26H27NO |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 2-[4-[(1Z)-1,2-diphenylbuta-1,3-dienyl]phenoxy]-N,N-dimethylethanamine |
| InChIKey | AJNFVDSYBLVCQL-QPLCGJKRSA-N |
| SMILES | CN(C)CCOC1=CC=C(C=C1)/C(=C(/C=C)\C2=CC=CC=C2)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)