Products 60407-52-5
CAS 60407-52-5 is the registry number for Medrylamine Maleate. Offered by: Mikromol. Available pack sizes: 50mg.
(Z)-but-2-enedioic acid;2-[(4-methoxyphenyl)-phenylmethoxy]-N,N-dimethylethanamine (CAS 60407-52-5) is a chemical compound with the molecular formula C22H27NO6 and a molecular weight of 401.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;2-[(4-methoxyphenyl)-phenylmethoxy]-N,N-dimethylethanamine. InChIKey: QPDBLTZVVSZATC-BTJKTKAUSA-N.
| Molecular formula | C22H27NO6 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;2-[(4-methoxyphenyl)-phenylmethoxy]-N,N-dimethylethanamine |
| InChIKey | QPDBLTZVVSZATC-BTJKTKAUSA-N |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=C(C=C2)OC.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Medrylamine Maleate