CAS 60434-71-1 appears in our catalog under these names: (S)-(-)-1,2-PROPANEDIOL DI-P-TOSYLATE, 9, (S)-Propane-1,2-diyl bis(4-methylbenzenesulfonate), 98%(LC-MS),RG, 98%(LC-MS),RG. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 5G, 100mg, 250mg, 1g.
2-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate (CAS 60434-71-1) is a chemical compound with the molecular formula C17H20O6S2 and a molecular weight of 384.5 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate. InChIKey: QSFWYZTZYVIPGD-UHFFFAOYSA-N.
| Molecular formula | C17H20O6S2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate |
| InChIKey | QSFWYZTZYVIPGD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C)OS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)