CAS 60492-61-7 is the registry number for 3,6-Diphenyl-1,4-dihydropyrazolo(4,3-c)pyrazole. Offered by: Biosynth. Available pack sizes: 250mg, 100mg.
3,6-diphenyl-1,4-dihydropyrazolo[3,4-d]pyrazole (CAS 60492-61-7) is a chemical compound with the molecular formula C16H12N4 and a molecular weight of 260.29 g/mol. IUPAC name: 3,6-diphenyl-1,4-dihydropyrazolo[3,4-d]pyrazole. InChIKey: NWJYQSXFBAIQQL-UHFFFAOYSA-N.
| Molecular formula | C16H12N4 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 3,6-diphenyl-1,4-dihydropyrazolo[3,4-d]pyrazole |
| InChIKey | NWJYQSXFBAIQQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC3=C2NN=C3C4=CC=CC=C4 |
Computed by PubChem (NCBI)