CAS 605-93-6 appears in our catalog under these names: 6-Methyl-1,4-naphthoquinone, 98.49%, 6-METHYL-1,4-NAPHTHOQUINONE, 98%, 6-Methyl-1,4-naphthoquinone, >95% (HPLC). Offered by: MedChemExpress, Fluorochem, TRC. Available pack sizes: 500 mg, 25 mg, 50 mg, 100 mg, 100mg, 250mg, 5g, 1g.
6-methylnaphthalene-1,4-dione (CAS 605-93-6) is a chemical compound with the molecular formula C11H8O2 and a molecular weight of 172.18 g/mol. IUPAC name: 6-methylnaphthalene-1,4-dione. InChIKey: OPKFWRVRCVCMJH-UHFFFAOYSA-N.
| Molecular formula | C11H8O2 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 6-methylnaphthalene-1,4-dione |
| InChIKey | OPKFWRVRCVCMJH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)C=CC2=O |
Computed by PubChem (NCBI)