CAS 60510-14-7 is the registry number for 2,4,6-Tribromobenzene-1,3,5-tricarbonitrile. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 2g, 1g.
2,4,6-tribromobenzene-1,3,5-tricarbonitrile (CAS 60510-14-7) is a chemical compound with the molecular formula C9Br3N3 and a molecular weight of 389.83 g/mol. IUPAC name: 2,4,6-tribromobenzene-1,3,5-tricarbonitrile. InChIKey: JFQCQELTUDXMQH-UHFFFAOYSA-N.
| Molecular formula | C9Br3N3 |
|---|---|
| Molecular weight | 389.83 g/mol |
| IUPAC name | 2,4,6-tribromobenzene-1,3,5-tricarbonitrile |
| InChIKey | JFQCQELTUDXMQH-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(C(=C(C(=C1Br)C#N)Br)C#N)Br |
Computed by PubChem (NCBI)