CAS 60524-15-4 appears in our catalog under these names: 2-Chloro-5-nitronicotinamide, 95%, 2–Chloro–5–nitronicotinamide, 2-Chloro-5-nitronicotinamide. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 5g, 2,5g.
2-chloro-5-nitropyridine-3-carboxamide (CAS 60524-15-4) is a chemical compound with the molecular formula C6H4ClN3O3 and a molecular weight of 201.57 g/mol. IUPAC name: 2-chloro-5-nitropyridine-3-carboxamide. InChIKey: ISGBAOSZUCMBKK-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3O3 |
|---|---|
| Molecular weight | 201.57 g/mol |
| IUPAC name | 2-chloro-5-nitropyridine-3-carboxamide |
| InChIKey | ISGBAOSZUCMBKK-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)