CAS 60530-85-0 is the registry number for 2-(((2-Amino-5-chlorophenyl)(2-fluorophenyl)methylene)amino)-ethanol. Offered by: TRC. Available pack sizes: 25mg.
5-phenyl-3-propan-2-yl-2-propan-2-ylimino-1,3,5-thiadiazinan-4-one (CAS 60530-85-0) is a chemical compound with the molecular formula C15H21N3OS and a molecular weight of 291.4 g/mol. IUPAC name: 5-phenyl-3-propan-2-yl-2-propan-2-ylimino-1,3,5-thiadiazinan-4-one. InChIKey: HSXMWAMNNUETHN-UHFFFAOYSA-N.
| Molecular formula | C15H21N3OS |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | 5-phenyl-3-propan-2-yl-2-propan-2-ylimino-1,3,5-thiadiazinan-4-one |
| InChIKey | HSXMWAMNNUETHN-UHFFFAOYSA-N |
| SMILES | CC(C)N=C1N(C(=O)N(CS1)C2=CC=CC=C2)C(C)C |
Computed by PubChem (NCBI)