CAS 6054-97-3 appears in our catalog under these names: Mordant yellow 3, 95%, MOrdant yellow 3, >95.0%(HPLC), >95.0%(HPLC), Chrome Yellow. Offered by: Combi-blocks, Chemat, GLPBio. Available pack sizes: 5g, 100g, 25g, 1g.
CAS 6054-97-3 identifies a chemical compound with the molecular formula C17H12N2NaO6S and a molecular weight of 395.3 g/mol. InChIKey: CQILDDBQCRFGQQ-UHFFFAOYSA-N.
| Molecular formula | C17H12N2NaO6S |
|---|---|
| Molecular weight | 395.3 g/mol |
| InChIKey | CQILDDBQCRFGQQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C=C1N=NC3=CC(=C(C=C3)O)C(=O)O.[Na] |
Computed by PubChem (NCBI)