CAS 6054-99-5 appears in our catalog under these names: Mordant Yellow 10 (Technical Grade), Mordant Yellow 10, Mordant Yellow 10 Staining intensity 90-100, Disodium 2-hydroxy-5-[2-(4-sulfonatophenyl)diazen-1-yl]benzoate. Offered by: TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 10g, 1g, 100g, 500g, 1000g, 1kg.
Disodium;4-[(3-carboxy-4-oxidophenyl)diazenyl]benzenesulfonate (CAS 6054-99-5) is a chemical compound with the molecular formula C13H8N2Na2O6S and a molecular weight of 366.26 g/mol. IUPAC name: disodium;4-[(3-carboxy-4-oxidophenyl)diazenyl]benzenesulfonate. InChIKey: YEVMULNVFDCUTD-UHFFFAOYSA-L.
| Molecular formula | C13H8N2Na2O6S |
|---|---|
| Molecular weight | 366.26 g/mol |
| IUPAC name | disodium;4-[(3-carboxy-4-oxidophenyl)diazenyl]benzenesulfonate |
| InChIKey | YEVMULNVFDCUTD-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1N=NC2=CC(=C(C=C2)[O-])C(=O)O)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)