CAS 60548-08-5 appears in our catalog under these names: 6,7-Dimethoxy-2-(piperazin-1-yl)quinazolin-4-amine dihydrochloride, 95%, N-Des((tetrahydrofuran-2-yl)methanone)) Terazosin Dihydrochloride, >95% (HPLC), 6,7-Dimethoxy-2-(piperazin-1-yl)quinazolin-4-amine dihydrochloride, 97%, 97%, 6,7-Dimethoxy-2-(piperazin-1-yl)quinazolin-4-amine dihydrochloride, 97%. Offered by: Combi-blocks, TRC, Chemat, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, 10mg, 50mg, 100mg, 25g.
6,7-dimethoxy-2-piperazin-1-ylquinazolin-4-amine;dihydrochloride (CAS 60548-08-5) is a chemical compound with the molecular formula C14H21Cl2N5O2 and a molecular weight of 362.3 g/mol. IUPAC name: 6,7-dimethoxy-2-piperazin-1-ylquinazolin-4-amine;dihydrochloride. InChIKey: WSCUPMCNACJUCB-UHFFFAOYSA-N.
| Molecular formula | C14H21Cl2N5O2 |
|---|---|
| Molecular weight | 362.3 g/mol |
| IUPAC name | 6,7-dimethoxy-2-piperazin-1-ylquinazolin-4-amine;dihydrochloride |
| InChIKey | WSCUPMCNACJUCB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCNCC3)N)OC.Cl.Cl |
Computed by PubChem (NCBI)