CAS 6055-72-7 appears in our catalog under these names: Adenine monohydrochloride hemihydrate, Adenine monohydrochloride hemihydrate/ 97.61% (existing batch purity), Adenine hydrochloride hydrate, Adenine Hydrochloride Hemihydrate, >98.0%(T), Adenine HCl Hemihydrate 97%. Offered by: GLPBio, TargetMol, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 1g, 100g, 25g, 100mg, 10g, 500g, 1mg.
7H-purin-6-amine;hydrate;hydrochloride (CAS 6055-72-7) is a chemical compound with the molecular formula C5H8ClN5O and a molecular weight of 189.60 g/mol. IUPAC name: 7H-purin-6-amine;hydrate;hydrochloride. InChIKey: MYRDTAUFFBYTHA-UHFFFAOYSA-N.
| Molecular formula | C5H8ClN5O |
|---|---|
| Molecular weight | 189.60 g/mol |
| IUPAC name | 7H-purin-6-amine;hydrate;hydrochloride |
| InChIKey | MYRDTAUFFBYTHA-UHFFFAOYSA-N |
| SMILES | C1=NC2=NC=NC(=C2N1)N.O.Cl |
Computed by PubChem (NCBI)