Products 60556-33-4

CAS 60556-33-4 is the registry number for Silanamine, 1-chloro-N-(1,1-dimethylethyl)-1,1-dimethyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

N-[chloro(dimethyl)silyl]-2-methylpropan-2-amine (CAS 60556-33-4) is a chemical compound with the molecular formula C6H16ClNSi and a molecular weight of 165.73 g/mol. IUPAC name: N-[chloro(dimethyl)silyl]-2-methylpropan-2-amine. InChIKey: CKWOGTUTBSUNSB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H16ClNSi
Molecular weight165.73 g/mol
IUPAC nameN-[chloro(dimethyl)silyl]-2-methylpropan-2-amine
InChIKeyCKWOGTUTBSUNSB-UHFFFAOYSA-N
SMILESCC(C)(C)N[Si](C)(C)Cl

Computed by PubChem (NCBI)