CAS 605630-37-3 appears in our catalog under these names: 2–Bromo–7–chloro–9,9–dimethyl–9H–fluorene, 2-Bromo-7-chloro-9,9-dimethyl-9H-fluorene, >95.0%(GC), 2-Bromo-7-chloro-9,9-dimethyl-9H-fluorene, 2-Bromo-7-chloro-9,9-dimethyl-9H-fluorene 97%, 2-Bromo-7-chloro-9,9-dimethyl-9H-fluorene, 97%, 97%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 50g, 100g, 10g, 1g.
2-bromo-7-chloro-9,9-dimethylfluorene (CAS 605630-37-3) is a chemical compound with the molecular formula C15H12BrCl and a molecular weight of 307.61 g/mol. IUPAC name: 2-bromo-7-chloro-9,9-dimethylfluorene. InChIKey: GTKHJVYKTOLTPB-UHFFFAOYSA-N.
| Molecular formula | C15H12BrCl |
|---|---|
| Molecular weight | 307.61 g/mol |
| IUPAC name | 2-bromo-7-chloro-9,9-dimethylfluorene |
| InChIKey | GTKHJVYKTOLTPB-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Cl)C3=C1C=C(C=C3)Br)C |
Computed by PubChem (NCBI)