CAS 605653-17-6 appears in our catalog under these names: 5-nitro-3-pyridinesulfonyl chloride, 5-nitropyridine-3-sulfonyl Chloride, 5-Nitropyridine-3-sulfonyl chloride, 95+%. Offered by: TRC, AmBeed. Available pack sizes: 500mg, 5g, 1g.
5-nitropyridine-3-sulfonyl chloride (CAS 605653-17-6) is a chemical compound with the molecular formula C5H3ClN2O4S and a molecular weight of 222.61 g/mol. IUPAC name: 5-nitropyridine-3-sulfonyl chloride. InChIKey: UEDNSYQELGGNEN-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O4S |
|---|---|
| Molecular weight | 222.61 g/mol |
| IUPAC name | 5-nitropyridine-3-sulfonyl chloride |
| InChIKey | UEDNSYQELGGNEN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)