CAS 606-04-2 appears in our catalog under these names: Pamabrom, Pamabrom, >95% (HPLC), Pamabrom/ 100%, Pamabrom, >98.0%(HPLC)(T), 1-Propanol, 2-amino-2-methyl-, compd. with 8-bromo-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione (1:1), 98.0%, 98.0%. Offered by: Chemat Brand, TRC, TargetMol, TCI, Chemat. Available pack sizes: on request, 100mg, 50g, 25mg, 50mg, 500mg, 1g, 5g.
2-amino-2-methylpropan-1-ol;8-bromo-1,3-dimethyl-7H-purine-2,6-dione (CAS 606-04-2) is a chemical compound with the molecular formula C11H18BrN5O3 and a molecular weight of 348.20 g/mol. IUPAC name: 2-amino-2-methylpropan-1-ol;8-bromo-1,3-dimethyl-7H-purine-2,6-dione. InChIKey: ATOTUUBRFJHZQG-UHFFFAOYSA-N.
| Molecular formula | C11H18BrN5O3 |
|---|---|
| Molecular weight | 348.20 g/mol |
| IUPAC name | 2-amino-2-methylpropan-1-ol;8-bromo-1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | ATOTUUBRFJHZQG-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)N.CN1C2=C(C(=O)N(C1=O)C)NC(=N2)Br |
Computed by PubChem (NCBI)