CAS 60610-05-1 is the registry number for Isobutyltriphenylphosphonium iodide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylpropyl(triphenyl)phosphanium (CAS 60610-05-1) is a chemical compound with the molecular formula C22H24P+ and a molecular weight of 319.4 g/mol. IUPAC name: 2-methylpropyl(triphenyl)phosphanium. InChIKey: CKFOWINHCJMUIT-UHFFFAOYSA-N.
| Molecular formula | C22H24P+ |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-methylpropyl(triphenyl)phosphanium |
| InChIKey | CKFOWINHCJMUIT-UHFFFAOYSA-N |
| SMILES | CC(C)C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)