CAS 60632-18-0 is the registry number for 3,5-Di-tert-butyl-4-hydroxybenzamide, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg, 50mg.
3,5-ditert-butyl-4-hydroxybenzamide (CAS 60632-18-0) is a chemical compound with the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. IUPAC name: 3,5-ditert-butyl-4-hydroxybenzamide. InChIKey: DGZQOKRGJUFPQC-UHFFFAOYSA-N.
| Molecular formula | C15H23NO2 |
|---|---|
| Molecular weight | 249.35 g/mol |
| IUPAC name | 3,5-ditert-butyl-4-hydroxybenzamide |
| InChIKey | DGZQOKRGJUFPQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C(=O)N |
Computed by PubChem (NCBI)