CAS 60656-74-8 is the registry number for 6-Chloro-2-(chloromethyl)-4-(2-fluorophenyl)quinazoline 3-Oxide. Offered by: TRC. Available pack sizes: 100mg, 1g.
6-chloro-2-(chloromethyl)-4-(2-fluorophenyl)-3-oxidoquinazolin-3-ium (CAS 60656-74-8) is a chemical compound with the molecular formula C15H9Cl2FN2O and a molecular weight of 323.1 g/mol. IUPAC name: 6-chloro-2-(chloromethyl)-4-(2-fluorophenyl)-3-oxidoquinazolin-3-ium. InChIKey: HKJMWTDLQYSQDH-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2FN2O |
|---|---|
| Molecular weight | 323.1 g/mol |
| IUPAC name | 6-chloro-2-(chloromethyl)-4-(2-fluorophenyl)-3-oxidoquinazolin-3-ium |
| InChIKey | HKJMWTDLQYSQDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=[N+](C(=NC3=C2C=C(C=C3)Cl)CCl)[O-])F |
Computed by PubChem (NCBI)