Products 60656-78-2
CAS 60656-78-2 is the registry number for 5-(Propan-2-yl)-2-(trifluoromethyl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-propan-2-yl-2-(trifluoromethyl)aniline (CAS 60656-78-2) is a chemical compound with the molecular formula C10H12F3N and a molecular weight of 203.20 g/mol. IUPAC name: 5-propan-2-yl-2-(trifluoromethyl)aniline. InChIKey: LLKPKSNAOBZKJY-UHFFFAOYSA-N.
| Molecular formula | C10H12F3N |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 5-propan-2-yl-2-(trifluoromethyl)aniline |
| InChIKey | LLKPKSNAOBZKJY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)