Products 60658-40-4
CAS 60658-40-4 appears in our catalog under these names: Undecanoic-d21 Acid, >95% (GC), Undecanoic-d21 Acid, 98 atom % D, min 98% Chemical Purity, Undecanoic acid–d21, Undecanoic acid-d21, 98.80%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g, 25mg, 25 mg, 50 mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosadeuterioundecanoic acid (CAS 60658-40-4) is a chemical compound with the molecular formula C11H22O2 and a molecular weight of 207.42 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosadeuterioundecanoic acid. InChIKey: ZDPHROOEEOARMN-SLBGAMDCSA-N.
| Molecular formula | C11H22O2 |
|---|---|
| Molecular weight | 207.42 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosadeuterioundecanoic acid |
| InChIKey | ZDPHROOEEOARMN-SLBGAMDCSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)