CAS 60668-24-8 appears in our catalog under these names: (S)-Alanyl-(r)-1-aminoethylphosphonic acid, 95%, L-Alanyl-L-1-aminoethylphosphonic Acid, >95% (HPLC), Alafosfalin, L-Alanyl-L-1-aminoethylphosphonic acid, 95.00%, Alafosfalin, 99.70%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 25mg, 50mg, 5mg, 2mg, 10mg, 100mg.
[(1R)-1-[[(2S)-2-aminopropanoyl]amino]ethyl]phosphonic acid (CAS 60668-24-8) is a chemical compound with the molecular formula C5H13N2O4P and a molecular weight of 196.14 g/mol. IUPAC name: [(1R)-1-[[(2S)-2-aminopropanoyl]amino]ethyl]phosphonic acid. InChIKey: BHAYDBSYOBONRV-IUYQGCFVSA-N.
| Molecular formula | C5H13N2O4P |
|---|---|
| Molecular weight | 196.14 g/mol |
| IUPAC name | [(1R)-1-[[(2S)-2-aminopropanoyl]amino]ethyl]phosphonic acid |
| InChIKey | BHAYDBSYOBONRV-IUYQGCFVSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)P(=O)(O)O)N |
Computed by PubChem (NCBI)