Products 60671-59-2

CAS 60671-59-2 appears in our catalog under these names: {((2–bromoethyl)sulfanyl)methyl}benzene, {((2-bromoethyl)sulfanyl)methyl}benzene, {[(2-bromoethyl)sulfanyl]methyl}benzene, 95%, {((2-bromoethyl)sulfanyl)methyl}benzene, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 2,5g, 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-bromoethylsulfanylmethylbenzene (CAS 60671-59-2) is a chemical compound with the molecular formula C9H11BrS and a molecular weight of 231.15 g/mol. IUPAC name: 2-bromoethylsulfanylmethylbenzene. InChIKey: YUSCZPWCIWNVSV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BrS
Molecular weight231.15 g/mol
IUPAC name2-bromoethylsulfanylmethylbenzene
InChIKeyYUSCZPWCIWNVSV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CSCCBr

Computed by PubChem (NCBI)