CAS 606944-47-2 appears in our catalog under these names: 3-[4-(2-Chlorophenoxy)phenylsulfonamido]benzoic acid, 95%, 3-(4-(2-Chlorophenoxy)phenylsulfonamido)benzoic acid, 98%, 3-((4-(2-Chlorophenoxy)phenyl)sulfonamido)benzoic acid, 98%, 98%, 3-((4-(2-Chlorophenoxy)phenyl)sulfonamido)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 5g, 1g, 100mg.
3-[[4-(2-chlorophenoxy)phenyl]sulfonylamino]benzoic acid (CAS 606944-47-2) is a chemical compound with the molecular formula C19H14ClNO5S and a molecular weight of 403.8 g/mol. IUPAC name: 3-[[4-(2-chlorophenoxy)phenyl]sulfonylamino]benzoic acid. InChIKey: QXSFFURZDXELKC-UHFFFAOYSA-N.
| Molecular formula | C19H14ClNO5S |
|---|---|
| Molecular weight | 403.8 g/mol |
| IUPAC name | 3-[[4-(2-chlorophenoxy)phenyl]sulfonylamino]benzoic acid |
| InChIKey | QXSFFURZDXELKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=CC=C(C=C2)S(=O)(=O)NC3=CC=CC(=C3)C(=O)O)Cl |
Computed by PubChem (NCBI)