CAS 60712-33-6 is the registry number for 3-Hydroxy-4-methoxy-tamoxifen Hydrochloride (E,Z mixture). Offered by: TRC. Available pack sizes: 100mg.
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine;hydrochloride (CAS 60712-33-6) is a chemical compound with the molecular formula C26H30ClNO and a molecular weight of 408.0 g/mol. IUPAC name: 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine;hydrochloride. InChIKey: FTDBIGNROSSDTJ-OQKDUQJOSA-N.
| Molecular formula | C26H30ClNO |
|---|---|
| Molecular weight | 408.0 g/mol |
| IUPAC name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine;hydrochloride |
| InChIKey | FTDBIGNROSSDTJ-OQKDUQJOSA-N |
| SMILES | CC/C(=C(\C1=CC=CC=C1)/C2=CC=C(C=C2)OCCN(C)C)/C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)