CAS 607378-18-7 appears in our catalog under these names: AZ 10606120 Dihydrochloride (~90%), AZ10606120 dihydrochloride/ 99.49% (existing batch purity), AZ 10606120 dihydrochloride, AZ 10606120 Dihydrochloride, AZ10606120 2HCl 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1mg, 2,5mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 100mg.
2-(1-adamantyl)-N-[2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide;dihydrochloride (CAS 607378-18-7) is a chemical compound with the molecular formula C25H36Cl2N4O2 and a molecular weight of 495.5 g/mol. IUPAC name: 2-(1-adamantyl)-N-[2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide;dihydrochloride. InChIKey: BVFONFUUWORSPO-UHFFFAOYSA-N.
| Molecular formula | C25H36Cl2N4O2 |
|---|---|
| Molecular weight | 495.5 g/mol |
| IUPAC name | 2-(1-adamantyl)-N-[2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide;dihydrochloride |
| InChIKey | BVFONFUUWORSPO-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CC(=O)NC4=CC=CC5=C4C=CC(=N5)NCCNCCO.Cl.Cl |
Computed by PubChem (NCBI)