Products 607737-00-8

CAS 607737-00-8 is the registry number for SUN-1334H (free base). Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[(E)-4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]but-2-enoxy]acetic acid (CAS 607737-00-8) is a chemical compound with the molecular formula C23H26F2N2O3 and a molecular weight of 416.5 g/mol. IUPAC name: 2-[(E)-4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]but-2-enoxy]acetic acid. InChIKey: PXQVDRLCSQHQTO-OWOJBTEDSA-N.

Identity
Molecular formulaC23H26F2N2O3
Molecular weight416.5 g/mol
IUPAC name2-[(E)-4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]but-2-enoxy]acetic acid
InChIKeyPXQVDRLCSQHQTO-OWOJBTEDSA-N
SMILESC1CN(CCN1C/C=C/COCC(=O)O)C(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F

Computed by PubChem (NCBI)

Synonyms: orb2564696