CAS 60788-53-6 appears in our catalog under these names: α-Phenyloxiranepropanenitrile, Alpha-Phenyloxiranepropanenitrile (mixture of diastereomers). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 50mg.
3-(oxiran-2-yl)-2-phenylpropanenitrile (CAS 60788-53-6) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 3-(oxiran-2-yl)-2-phenylpropanenitrile. InChIKey: VQSRPYDEVXQYKT-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 3-(oxiran-2-yl)-2-phenylpropanenitrile |
| InChIKey | VQSRPYDEVXQYKT-UHFFFAOYSA-N |
| SMILES | C1C(O1)CC(C#N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)