Products 608-40-2
CAS 608-40-2 appears in our catalog under these names: Meso-2,3-dimethylsuccinic acid, 95%, Meso-2,3-Dimethylsuccinic Acid, meso–2,3–Dimethylsuccinic acid, MESO-2,3-DIMETHYLSUCCINIC ACID, 99%, meso-2,3-Dimethylsuccinic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
(2R,3S)-2,3-dimethylbutanedioic acid (CAS 608-40-2) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. IUPAC name: (2R,3S)-2,3-dimethylbutanedioic acid. InChIKey: KLZYRCVPDWTZLH-ZXZARUISSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 146.14 g/mol |
| IUPAC name | (2R,3S)-2,3-dimethylbutanedioic acid |
| InChIKey | KLZYRCVPDWTZLH-ZXZARUISSA-N |
| SMILES | C[C@H]([C@H](C)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
rel-(2R,3S)-2,3-Dimethylbutanedioic acid, meso-2,3-Dimethylsuccinic acid, (2R,3S)-2,3-dimethylbutanedioic acid, (2R,3S)-2,3-dimethylsuccinic acid, trans-2,3-Dimethylsuccinic acid, erythro-2,3-Dimethylsuccinic acid, Butanedioic acid, 2,3-dimethyl-, (R*,S*)-, Succinic acid,3-dimethyl-, erythro-meso-, Butanedioic acid,3-dimethyl-, (R*,S*)-, Butanedioic acid,3-dimethyl-, [R-(R*,S*)]-