CAS 608-54-8 is the registry number for L-Arabinaric acid dipotassium salt. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg.
Dipotassium;2,3,4-trihydroxypentanedioate (CAS 608-54-8) is a chemical compound with the molecular formula C5H6K2O7 and a molecular weight of 256.29 g/mol. IUPAC name: dipotassium;2,3,4-trihydroxypentanedioate. InChIKey: WNTXLGRNHLBLIA-UHFFFAOYSA-L.
| Molecular formula | C5H6K2O7 |
|---|---|
| Molecular weight | 256.29 g/mol |
| IUPAC name | dipotassium;2,3,4-trihydroxypentanedioate |
| InChIKey | WNTXLGRNHLBLIA-UHFFFAOYSA-L |
| SMILES | C(C(C(=O)[O-])O)(C(C(=O)[O-])O)O.[K+].[K+] |
Computed by PubChem (NCBI)