CAS 60803-31-8 appears in our catalog under these names: 3,3'-Dibromo-5,5'-di-tert-butyl-1,1'-biphenyl-4,4'-diol, 95%, 2-Bromo-4-(3-bromo-5-tert-butyl-4-hydroxyphenyl)-6-tert-butylphenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-bromo-4-(3-bromo-5-tert-butyl-4-hydroxyphenyl)-6-tert-butylphenol (CAS 60803-31-8) is a chemical compound with the molecular formula C20H24Br2O2 and a molecular weight of 456.2 g/mol. IUPAC name: 2-bromo-4-(3-bromo-5-tert-butyl-4-hydroxyphenyl)-6-tert-butylphenol. InChIKey: VDYANGBPOVDLEB-UHFFFAOYSA-N.
| Molecular formula | C20H24Br2O2 |
|---|---|
| Molecular weight | 456.2 g/mol |
| IUPAC name | 2-bromo-4-(3-bromo-5-tert-butyl-4-hydroxyphenyl)-6-tert-butylphenol |
| InChIKey | VDYANGBPOVDLEB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC(=C1)C2=CC(=C(C(=C2)Br)O)C(C)(C)C)Br)O |
Computed by PubChem (NCBI)