CAS 608140-72-3 appears in our catalog under these names: Potassium 2-(oxiran-2-yl)ethyltrifluoroborate, 95%, Potassium 2-(oxiran-2-yl)ethyltrifluoroborate. Offered by: Combi-blocks, AmBeed, TRC. Available pack sizes: 250mg, 5g, 10mg, 25mg, 5mg.
Potassium trifluoro-[2-(oxiran-2-yl)ethyl]boranuide (CAS 608140-72-3) is a chemical compound with the molecular formula C4H7BF3KO and a molecular weight of 178.00 g/mol. IUPAC name: potassium trifluoro-[2-(oxiran-2-yl)ethyl]boranuide. InChIKey: WPPKXHVWPKSEAR-UHFFFAOYSA-N.
| Molecular formula | C4H7BF3KO |
|---|---|
| Molecular weight | 178.00 g/mol |
| IUPAC name | potassium trifluoro-[2-(oxiran-2-yl)ethyl]boranuide |
| InChIKey | WPPKXHVWPKSEAR-UHFFFAOYSA-N |
| SMILES | [B-](CCC1CO1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)