CAS 6083-79-0 appears in our catalog under these names: 3–Nitro–4–thiocyanatobenzoic acid, 3-Nitro-4-thiocyanatobenzoic acid 97%, 4-(CYANOSULFANYL)-3-NITROBENZOIC ACID, 97%, 97%, 4-(CYANOSULFANYL)-3-NITROBENZOIC ACID, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-nitro-4-thiocyanatobenzoic acid (CAS 6083-79-0) is a chemical compound with the molecular formula C8H4N2O4S and a molecular weight of 224.20 g/mol. IUPAC name: 3-nitro-4-thiocyanatobenzoic acid. InChIKey: HQDASRYDGNESOF-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O4S |
|---|---|
| Molecular weight | 224.20 g/mol |
| IUPAC name | 3-nitro-4-thiocyanatobenzoic acid |
| InChIKey | HQDASRYDGNESOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])SC#N |
Computed by PubChem (NCBI)