CAS 60833-82-1 is the registry number for Bz-arg-4-abz-oh hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
4-[[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]amino]benzoic acid (CAS 60833-82-1) is a chemical compound with the molecular formula C20H23N5O4 and a molecular weight of 397.4 g/mol. IUPAC name: 4-[[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]amino]benzoic acid. InChIKey: TUZAVLAUJHUFLA-INIZCTEOSA-N.
| Molecular formula | C20H23N5O4 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 4-[[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]amino]benzoic acid |
| InChIKey | TUZAVLAUJHUFLA-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)