CAS 60836-10-4 is the registry number for 1,5–Bis(trimethylsilyl)penta–1,4–diyn–3–one. Offered by: GLPBio. Available pack sizes: 100mg.
1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one (CAS 60836-10-4) is a chemical compound with the molecular formula C11H18OSi2 and a molecular weight of 222.43 g/mol. IUPAC name: 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one. InChIKey: PKWQXPKFOHOUGK-UHFFFAOYSA-N.
| Molecular formula | C11H18OSi2 |
|---|---|
| Molecular weight | 222.43 g/mol |
| IUPAC name | 1,5-bis(trimethylsilyl)penta-1,4-diyn-3-one |
| InChIKey | PKWQXPKFOHOUGK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC(=O)C#C[Si](C)(C)C |
Computed by PubChem (NCBI)